cas: 201002-47-3 — see every product listed under this CAS number, including other names
N2-Fmoc-D-lysine Hydrochloride, 96% (CAS 201002-47-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg, 50g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F546833-1G |
| cas | 201002-47-3 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 25g | 492.55 Pln | |
| Fluorochem | 100g | 1726.49 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 25g | 381.20 Pln | |
| Chemat | 50g | 702.80 Pln | |
| Chemat | 100g | 1341.20 Pln |
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride (CAS 201002-47-3) is a chemical compound with the molecular formula C21H25ClN2O4 and a molecular weight of 404.9 g/mol. IUPAC name: (2R)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride. InChIKey: MVMZFAIUUXYFGY-FSRHSHDFSA-N.
| Molecular formula | C21H25ClN2O4 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | (2R)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride |
| InChIKey | MVMZFAIUUXYFGY-FSRHSHDFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCCN)C(=O)O.Cl |
Computed by PubChem (NCBI)