NEPA 97%
cas: 82717-96-2 — see every product listed under this CAS number, including other names
NEPA 97% (CAS 82717-96-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A161643-5g |
| cas | 82717-96-2 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 298.06 Pln | |
| Ambeed | 500g | 1171.38 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A161643 |
(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid (CAS 82717-96-2) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid. InChIKey: CEIWXEQZZZHLDM-AAEUAGOBSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoic acid |
| InChIKey | CEIWXEQZZZHLDM-AAEUAGOBSA-N |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
N-[(S)-1-Ethoxycarbonyl-3-phenylpropyl]-L-alanine, N-(1(S)-ethoxycarbonyl-3-phenylpropyl)-L-alanine, N-[1(S)-ethoxycarbonyl-3-phenylpropyl]-L-alanine, RAMIPRIL IMPURITY F [EP IMPURITY], (2S)-2-(((1S)-1-(Ethoxycarbonyl)-3-phenylpropyl)amino)propanoic acid, ENALAPRIL MALEATE IMPURITY B [EP IMPURITY], ENALAPRILAT DIHYDRATE IMPURITY F [EP IMPURITY], QUINAPRIL HYDROCHLORIDE IMPURITY B [EP IMPURITY], SPIRAPRIL HYDROCHLORIDE MONOHYDRATE IMPURITY C [EP IMPURITY], (2S)-2-{[(1S)-1-(ethoxycarbonyl)-3-phenylpropyl]amino}propanoic acid