Products 898211-21-7
CAS 898211-21-7 appears in our catalog under these names: NOX-6-18/ 99.29% (existing batch purity), GPR132 antagonist 1, GPR132 antagonist 1, GPR132 antagonist 1, 99.72%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 10 mg.
3-methyl-5-(2-phenylethylsulfamoyl)-1-benzofuran-2-carboxylic acid (CAS 898211-21-7) is a chemical compound with the molecular formula C18H17NO5S and a molecular weight of 359.4 g/mol. IUPAC name: 3-methyl-5-(2-phenylethylsulfamoyl)-1-benzofuran-2-carboxylic acid. InChIKey: XFMCZHXUAWBOAL-UHFFFAOYSA-N.
| Molecular formula | C18H17NO5S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 3-methyl-5-(2-phenylethylsulfamoyl)-1-benzofuran-2-carboxylic acid |
| InChIKey | XFMCZHXUAWBOAL-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2)S(=O)(=O)NCCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)