Products 42200-33-9
CAS 42200-33-9 appears in our catalog under these names: Nadolol, 95%, Nadolol, >95% (HPLC), Nadolol, Nadolol 1.0 mg/ml in Methanol, Nadolol, 95.00%. Offered by: Combi-blocks, TRC, LoGiCal, Dr. Ehrenstorfer, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg, 10mg, 1ml, 10mM (in 1ml dmso).
(2R,3S)-5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol (CAS 42200-33-9) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: (2R,3S)-5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol. InChIKey: VWPOSFSPZNDTMJ-UCWKZMIHSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (2R,3S)-5-[3-(tert-butylamino)-2-hydroxypropoxy]-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| InChIKey | VWPOSFSPZNDTMJ-UCWKZMIHSA-N |
| SMILES | CC(C)(C)NCC(COC1=CC=CC2=C1C[C@@H]([C@@H](C2)O)O)O |
Computed by PubChem (NCBI)