cas: 2243-56-3 — see every product listed under this CAS number, including other names
Naphthalen-1-ylhydrazine hydrochloride, 98%, 98% (CAS 2243-56-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EJS-100mg |
| cas | 2243-56-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 160.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Naphthalen-1-ylhydrazine;hydrochloride (CAS 2243-56-3) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: naphthalen-1-ylhydrazine;hydrochloride. InChIKey: FYSSYOCJFZSKNW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | naphthalen-1-ylhydrazine;hydrochloride |
| InChIKey | FYSSYOCJFZSKNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NN.Cl |
Computed by PubChem (NCBI)