Naphthalene-2-sulfonyl fluoride 95%
cas: 325-12-2 — see every product listed under this CAS number, including other names
Naphthalene-2-sulfonyl fluoride 95% (CAS 325-12-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1072600-250mg |
| cas | 325-12-2 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 693.00 Pln | |
| Ambeed | 10g | 1282.62 Pln | |
| Ambeed | 25g | 2489.69 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1072600 |
Naphthalene-2-sulfonyl fluoride (CAS 325-12-2) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: naphthalene-2-sulfonyl fluoride. InChIKey: LGWYRYDAHZTSKX-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | naphthalene-2-sulfonyl fluoride |
| InChIKey | LGWYRYDAHZTSKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)