CAS 317-55-5 appears in our catalog under these names: 1-Naphthalenesulfonyl fluoride, 95%, 1-Naphthalenesulfonyl fluoride, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 1g, 10g, 25g, 50g, 100g, 200g, 300g.
Naphthalene-1-sulfonyl fluoride (CAS 317-55-5) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: naphthalene-1-sulfonyl fluoride. InChIKey: MYKMYBMCWFRCHA-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | naphthalene-1-sulfonyl fluoride |
| InChIKey | MYKMYBMCWFRCHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2S(=O)(=O)F |
Computed by PubChem (NCBI)