Products 852940-49-9
CAS 852940-49-9 appears in our catalog under these names: 4-Fluoro-3-methyl-1-benzothiophene-2-carboxylic acid, 95%, 4–Fluoro–3–methylbenzo(b)thiophene–2–carboxylic acid, 4-Fluoro-3-methyl-1-benzothiophene-2-carboxylic acid, 4-Fluoro-3-methylbenzo[b]thiophene-2-carboxylic acid 97%, 4-Fluoro-3-methylbenzo[b]thiophene-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 5g.
4-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid (CAS 852940-49-9) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: 4-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: SLKHVQZFOWEYQS-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | SLKHVQZFOWEYQS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=CC=CC(=C12)F)C(=O)O |
Computed by PubChem (NCBI)