CAS 325-12-2 appears in our catalog under these names: 2-NAPHTHALENESULFONYL FLUORIDE, naphthalene-2-sulfonyl fluoride, 95%, Naphthalene-2-sulfonyl fluoride 95%. Offered by: Sigma-Aldrich, Combi-blocks, Ambeed. Available pack sizes: 1G, 10g, 5g, 250mg, 25g.
Naphthalene-2-sulfonyl fluoride (CAS 325-12-2) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: naphthalene-2-sulfonyl fluoride. InChIKey: LGWYRYDAHZTSKX-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | naphthalene-2-sulfonyl fluoride |
| InChIKey | LGWYRYDAHZTSKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)