CAS 154630-32-7 appears in our catalog under these names: 5-Fluoro-benzo[b]thiophene-2-carboxylic acid methyl ester, 95%, 5-Fluoro-benzo[b]thiophene-2-carboxylic acid methyl ester, 96%, 96%, Methyl 5-fluorobenzo[b]thiophene-2-carboxylate, 96%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
Methyl 5-fluoro-1-benzothiophene-2-carboxylate (CAS 154630-32-7) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: methyl 5-fluoro-1-benzothiophene-2-carboxylate. InChIKey: KMBHCZSECUMYRF-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl 5-fluoro-1-benzothiophene-2-carboxylate |
| InChIKey | KMBHCZSECUMYRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=CC(=C2)F |
Computed by PubChem (NCBI)