cas: 38302-15-7 — see every product listed under this CAS number, including other names
Naringenin trimethyl ether, 99%, 99% (CAS 38302-15-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CHVF-10mg |
| cas | 38302-15-7 |
| size | 10mg |
| availability | 0.03g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 429.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (CAS 38302-15-7) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: MQFSCAHSIUPLSB-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 5,7-dimethoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | MQFSCAHSIUPLSB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CC(=O)C3=C(O2)C=C(C=C3OC)OC |
Computed by PubChem (NCBI)