CAS 1251537-11-7 appears in our catalog under these names: Navamepent/ 99.09% (existing batch purity), Navamepent, Navamepent, 98%, 98%, Navamepent, 98.03%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 10 mg.
Propan-2-yl (5S,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate (CAS 1251537-11-7) is a chemical compound with the molecular formula C18H24O4 and a molecular weight of 304.4 g/mol. IUPAC name: propan-2-yl (5S,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate. InChIKey: ZVOCIIHCJJEFRQ-BHXBHYJPSA-N.
| Molecular formula | C18H24O4 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | propan-2-yl (5S,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate |
| InChIKey | ZVOCIIHCJJEFRQ-BHXBHYJPSA-N |
| SMILES | CC(C)OC(=O)CCC[C@@H](C#C/C=C/C=C/[C@@H](CC#C)O)O |
Computed by PubChem (NCBI)