Products 1391980-92-9
CAS 1391980-92-9 appears in our catalog under these names: Necroptosis–IN–1, Necroptosis-IN-1/ 99.26% (existing batch purity), Necroptosis-in-1, Necroptosis-IN-1, 98.60%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 100mg, 200mg, 50 mg.
5-[(7-chloro-1H-indol-3-yl)methyl]imidazolidine-2,4-dione (CAS 1391980-92-9) is a chemical compound with the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. IUPAC name: 5-[(7-chloro-1H-indol-3-yl)methyl]imidazolidine-2,4-dione. InChIKey: HAPHEBPGIQHYHN-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O2 |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | 5-[(7-chloro-1H-indol-3-yl)methyl]imidazolidine-2,4-dione |
| InChIKey | HAPHEBPGIQHYHN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC=C2CC3C(=O)NC(=O)N3 |
Computed by PubChem (NCBI)