CAS 2718971-86-7 is the registry number for 5-Chloro-7,8-dimethoxyimidazo[1,2-a]quinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-7,8-dimethoxyimidazo[1,2-a]quinazoline (CAS 2718971-86-7) is a chemical compound with the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. IUPAC name: 5-chloro-7,8-dimethoxyimidazo[1,2-a]quinazoline. InChIKey: ZDLQNCGOTYCECW-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O2 |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | 5-chloro-7,8-dimethoxyimidazo[1,2-a]quinazoline |
| InChIKey | ZDLQNCGOTYCECW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC3=NC=CN23)Cl)OC |
Computed by PubChem (NCBI)