Products 1150163-89-5
CAS 1150163-89-5 is the registry number for Methyl 2-amino-4-(3-chlorophenyl)pyrimidine-5-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.
Methyl 2-amino-4-(3-chlorophenyl)pyrimidine-5-carboxylate (CAS 1150163-89-5) is a chemical compound with the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. IUPAC name: methyl 2-amino-4-(3-chlorophenyl)pyrimidine-5-carboxylate. InChIKey: PTDABCBHVHXZRI-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O2 |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | methyl 2-amino-4-(3-chlorophenyl)pyrimidine-5-carboxylate |
| InChIKey | PTDABCBHVHXZRI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(N=C1C2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)