CAS 61471-95-2 is the registry number for N-(Benzo[d][1,3]dioxol-5-ylmethyl)-6-chloropyridazin-3-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-benzodioxol-5-ylmethyl)-6-chloropyridazin-3-amine (CAS 61471-95-2) is a chemical compound with the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. IUPAC name: N-(1,3-benzodioxol-5-ylmethyl)-6-chloropyridazin-3-amine. InChIKey: XQYZUTAMBGXARU-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O2 |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-ylmethyl)-6-chloropyridazin-3-amine |
| InChIKey | XQYZUTAMBGXARU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC3=NN=C(C=C3)Cl |
Computed by PubChem (NCBI)