CAS 196308-41-5 is the registry number for (4-Amino-5-chloro-2,3-dihydrobenzofuran-7-yl)(1H-imidazol-1-yl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-yl)-imidazol-1-ylmethanone (CAS 196308-41-5) is a chemical compound with the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. IUPAC name: (4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-yl)-imidazol-1-ylmethanone. InChIKey: IUAFEQUAFKFZLA-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O2 |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | (4-amino-5-chloro-2,3-dihydro-1-benzofuran-7-yl)-imidazol-1-ylmethanone |
| InChIKey | IUAFEQUAFKFZLA-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C(=C(C=C2C(=O)N3C=CN=C3)Cl)N |
Computed by PubChem (NCBI)