CAS 5409-62-1 appears in our catalog under these names: 3-(Methyl(phenylmethyl)amino)-1-phenyl-1-propanone hydrochloride, 3-(Benzyl(methyl)amino)-1-phenylpropanone hydrochloride 98+%, Atomoxetine Impurity 13, 3-(Benzyl(methyl)amino)-1-phenylpropanone hydrochloride, 98%, 98%, 3-(N-Benzyl-N-methylamino)propiophenone hydrochloride, 98+%. Offered by: Biosynth, Ambeed, Chemat Brand, Chemat, Fluorochem. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg, 100mg, 250mg, 1g, 5g.
3-[benzyl(methyl)amino]-1-phenylpropan-1-one;hydrochloride (CAS 5409-62-1) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: 3-[benzyl(methyl)amino]-1-phenylpropan-1-one;hydrochloride. InChIKey: UQMCPHGYLMSEPN-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 3-[benzyl(methyl)amino]-1-phenylpropan-1-one;hydrochloride |
| InChIKey | UQMCPHGYLMSEPN-UHFFFAOYSA-N |
| SMILES | CN(CCC(=O)C1=CC=CC=C1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)