CAS 53625-25-5 is the registry number for (-)-Nefopam Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
(R)-nefopam hydrochloride is a hydrochloride obtained by reaction of (R)-nefopam with one equivalent of hydrochloric acid (the racemic salt is an analgesic drug). It contains a (R)-nefopam(1+). It is an enantiomer of a (S)-nefopam hydrochloride.
Source: ChEBI
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | (1R)-5-methyl-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride |
| InChIKey | CNNVSINJDJNHQK-UNTBIKODSA-N |
| SMILES | CN1CCO[C@@H](C2=CC=CC=C2C1)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)