Products 1346603-30-2
CAS 1346603-30-2 appears in our catalog under these names: Nefopam-d3 Hydrochloride, >95% (HPLC), Nefopam D3 hydrochloride, Nefopam-d3 (hydrochloride), 98.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 5 mg.
1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride (CAS 1346603-30-2) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 292.8 g/mol. IUPAC name: 1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride. InChIKey: CNNVSINJDJNHQK-NIIDSAIPSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 292.8 g/mol |
| IUPAC name | 1-phenyl-5-(trideuteriomethyl)-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride |
| InChIKey | CNNVSINJDJNHQK-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])N1CCOC(C2=CC=CC=C2C1)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)