Products 1953130-87-4
CAS 1953130-87-4 appears in our catalog under these names: Nesolicaftor/ 98.64% (existing batch purity), PTI-428, Nesolicaftor, Nesolicaftor, 99.37%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 50 mg.
N-[3-[5-[(1R)-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide (CAS 1953130-87-4) is a chemical compound with the molecular formula C18H18N4O4 and a molecular weight of 354.4 g/mol. IUPAC name: N-[3-[5-[(1R)-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide. InChIKey: XPEHHUISIBFLHX-QFWMXSHPSA-N.
| Molecular formula | C18H18N4O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | N-[3-[5-[(1R)-1-hydroxyethyl]-1,3,4-oxadiazol-2-yl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide |
| InChIKey | XPEHHUISIBFLHX-QFWMXSHPSA-N |
| SMILES | C[C@H](C1=NN=C(O1)C2CC(C2)NC(=O)C3=CC(=NO3)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)