cas: 28928-97-4 — see every product listed under this CAS number, including other names
Nonenylsuccinic Anhydride, 90%, 90% (CAS 28928-97-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113X4I-5g |
| cas | 28928-97-4 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Chemat | 100g | 410.00 Pln | |
| Chemat | 250g | 563.60 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
3-[(E)-non-1-enyl]oxolane-2,5-dione (CAS 28928-97-4) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: 3-[(E)-non-1-enyl]oxolane-2,5-dione. InChIKey: FGQUIQAGZLBOGL-CMDGGOBGSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 3-[(E)-non-1-enyl]oxolane-2,5-dione |
| InChIKey | FGQUIQAGZLBOGL-CMDGGOBGSA-N |
| SMILES | CCCCCCC/C=C/C1CC(=O)OC1=O |
Computed by PubChem (NCBI)