cas: 28928-97-4 — see every product listed under this CAS number, including other names
Nonenylsuccinicanhydride, 95% (CAS 28928-97-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A434486-5g |
| cas | 28928-97-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 278.32 Pln | |
| AmBeed | 1g | 154.63 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(E)-non-1-enyl]oxolane-2,5-dione (CAS 28928-97-4) is a chemical compound with the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. IUPAC name: 3-[(E)-non-1-enyl]oxolane-2,5-dione. InChIKey: FGQUIQAGZLBOGL-CMDGGOBGSA-N.
| Molecular formula | C13H20O3 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 3-[(E)-non-1-enyl]oxolane-2,5-dione |
| InChIKey | FGQUIQAGZLBOGL-CMDGGOBGSA-N |
| SMILES | CCCCCCC/C=C/C1CC(=O)OC1=O |
Computed by PubChem (NCBI)