Products 1389310-69-3
CAS 1389310-69-3 appears in our catalog under these names: NorA-IN-1/ 95.01% (existing batch purity), NorA–IN–1, NorA-IN-1, NorA-IN-1, 96.55%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
(E)-1-(4-hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one (CAS 1389310-69-3) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: (E)-1-(4-hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one. InChIKey: UJQJEKOZLIGAHH-CMDGGOBGSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | (E)-1-(4-hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | UJQJEKOZLIGAHH-CMDGGOBGSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)/C=C/C(=O)C2=CC=C(C=C2)O)OC |
Computed by PubChem (NCBI)