cas: 15256-10-7 — see every product listed under this CAS number, including other names
O-(3,4-Dichlorobenzyl)hydroxylamine hydrochloride 95% (CAS 15256-10-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A882986-100mg |
| cas | 15256-10-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 798.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A882986 |
O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride (CAS 15256-10-7) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: LEUZSWJUEHCRFM-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | LEUZSWJUEHCRFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CON)Cl)Cl.Cl |
Computed by PubChem (NCBI)