Products 379229-30-8

CAS 379229-30-8 appears in our catalog under these names: 2,4-Dichloro-5-methoxyaniline hydrochloride, 95%, 2,4-Dichloro-5-methoxyaniline hydrochloride, 95+%, 2,4-Dichloro-5-methoxyaniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100g, 25g, 500g, 5g, 1g.

Structural formula: {0} (CAS {1})

2,4-dichloro-5-methoxyaniline;hydrochloride (CAS 379229-30-8) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: 2,4-dichloro-5-methoxyaniline;hydrochloride. InChIKey: NYMNXZXMNGXNIF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl3NO
Molecular weight228.5 g/mol
IUPAC name2,4-dichloro-5-methoxyaniline;hydrochloride
InChIKeyNYMNXZXMNGXNIF-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)N)Cl)Cl.Cl

Computed by PubChem (NCBI)