CAS 379229-30-8 appears in our catalog under these names: 2,4-Dichloro-5-methoxyaniline hydrochloride, 95%, 2,4-Dichloro-5-methoxyaniline hydrochloride, 95+%, 2,4-Dichloro-5-methoxyaniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100g, 25g, 500g, 5g, 1g.
2,4-dichloro-5-methoxyaniline;hydrochloride (CAS 379229-30-8) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: 2,4-dichloro-5-methoxyaniline;hydrochloride. InChIKey: NYMNXZXMNGXNIF-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | 2,4-dichloro-5-methoxyaniline;hydrochloride |
| InChIKey | NYMNXZXMNGXNIF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)