cas: 15256-10-7 — see every product listed under this CAS number, including other names
O-(3,4-Dichlorobenzyl)hydroxylamine hydrochloride, 95%, 95% (CAS 15256-10-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118JF2-100mg |
| cas | 15256-10-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 645.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride (CAS 15256-10-7) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: LEUZSWJUEHCRFM-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | LEUZSWJUEHCRFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CON)Cl)Cl.Cl |
Computed by PubChem (NCBI)