CAS 15256-10-7 appears in our catalog under these names: O-(3,4-Dichlorobenzyl)hydroxylamine hydrochloride, 95%, 4-((Aminooxy)methyl)-1,2-dichlorobenzenehydrochloride, O-(3,4-Dichlorobenzyl)hydroxylamine hydrochloride 95%, O-(3,4-Dichlorobenzyl)hydroxylamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride (CAS 15256-10-7) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: LEUZSWJUEHCRFM-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | O-[(3,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | LEUZSWJUEHCRFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CON)Cl)Cl.Cl |
Computed by PubChem (NCBI)