CAS 317821-71-9 is the registry number for 2-[(Aminooxy)methyl]-1,4-dichlorobenzene hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
O-[(2,5-dichlorophenyl)methyl]hydroxylamine;hydrochloride (CAS 317821-71-9) is a chemical compound with the molecular formula C7H8Cl3NO and a molecular weight of 228.5 g/mol. IUPAC name: O-[(2,5-dichlorophenyl)methyl]hydroxylamine;hydrochloride. InChIKey: UQXASGKUHLPWIR-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3NO |
|---|---|
| Molecular weight | 228.5 g/mol |
| IUPAC name | O-[(2,5-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| InChIKey | UQXASGKUHLPWIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CON)Cl.Cl |
Computed by PubChem (NCBI)