cas: 5538-51-2 — see every product listed under this CAS number, including other names
O-Acetylsalicyloyl Chloride, >97.0%(HPLC)(T) (CAS 5538-51-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1917-5G |
| cas | 5538-51-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 193.59 Pln | |
| TCI | 25g | 424.70 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(HPLC)(T) |
(2-carbonochloridoylphenyl) acetate (CAS 5538-51-2) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: (2-carbonochloridoylphenyl) acetate. InChIKey: DSGKWFGEUBCEIE-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | (2-carbonochloridoylphenyl) acetate |
| InChIKey | DSGKWFGEUBCEIE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)Cl |
Computed by PubChem (NCBI)