cas: 2380459-95-8 — see every product listed under this CAS number, including other names
O2-tert-butyl O3-ethyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate, 97% (CAS 2380459-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F874757-100MG |
| cas | 2380459-95-8 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2148.22 Pln | |
| Fluorochem | 250mg | 3366.54 Pln | |
| Fluorochem | 500mg | 5511.62 Pln | |
| Fluorochem | 1g | 8135.69 Pln | |
| Fluorochem | 5g | 25051.61 Pln | |
| Chemat | 100mg | 1082.00 Pln | |
| Chemat | 250mg | 1696.40 Pln | |
| Chemat | 500mg | 2757.20 Pln | |
| Chemat | 1g | 4149.20 Pln | |
| Chemat | 5g | 12726.80 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate (CAS 2380459-95-8) is a chemical compound with the molecular formula C15H25NO5 and a molecular weight of 299.36 g/mol. IUPAC name: 2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate. InChIKey: OQSAJJZJGXXGDD-QCNOEVLYSA-N.
| Molecular formula | C15H25NO5 |
|---|---|
| Molecular weight | 299.36 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate |
| InChIKey | OQSAJJZJGXXGDD-QCNOEVLYSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2CC[C@H](N1C(=O)OC(C)(C)C)C[C@H]2O |
Computed by PubChem (NCBI)