Products 57079-16-0

CAS 57079-16-0 is the registry number for N-(10-Carboxydecanyl)maleamideic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

11-[[(Z)-3-carboxyprop-2-enoyl]amino]undecanoic acid (CAS 57079-16-0) is a chemical compound with the molecular formula C15H25NO5 and a molecular weight of 299.36 g/mol. IUPAC name: 11-[[(Z)-3-carboxyprop-2-enoyl]amino]undecanoic acid. InChIKey: RSFCDQINXWHUEN-KHPPLWFESA-N.

Identity
Molecular formulaC15H25NO5
Molecular weight299.36 g/mol
IUPAC name11-[[(Z)-3-carboxyprop-2-enoyl]amino]undecanoic acid
InChIKeyRSFCDQINXWHUEN-KHPPLWFESA-N
SMILESC(CCCCCNC(=O)/C=C\C(=O)O)CCCCC(=O)O

Computed by PubChem (NCBI)