Products 38393-73-6
CAS 38393-73-6 is the registry number for OAT1/3-IN-1. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 1 mg.
2,7,8-trihydroxy-1-methoxy-3-methylanthracene-9,10-dione (CAS 38393-73-6) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 2,7,8-trihydroxy-1-methoxy-3-methylanthracene-9,10-dione. InChIKey: RVURFFCNSWQLMO-UHFFFAOYSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 2,7,8-trihydroxy-1-methoxy-3-methylanthracene-9,10-dione |
| InChIKey | RVURFFCNSWQLMO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)OC)C(=O)C3=C(C2=O)C=CC(=C3O)O |
Computed by PubChem (NCBI)