CAS 488847-28-5 appears in our catalog under these names: ORM-10103/ 99.15% (existing batch purity), ORM-10103, ORM-10103, 99.43%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 200mg.
5-nitro-2-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridine (CAS 488847-28-5) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: 5-nitro-2-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridine. InChIKey: GZONLGPIHCCJOI-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 5-nitro-2-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridine |
| InChIKey | GZONLGPIHCCJOI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)OC3=NC=C(C=C3)[N+](=O)[O-])OC1C4=CC=CC=C4 |
Computed by PubChem (NCBI)