Products 943119-42-4
CAS 943119-42-4 appears in our catalog under these names: OUL232/ 99.04% (existing batch purity), OUL232, OUL232 99%, OUL232, 99.86%, OUL232, 99%, 99%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 100 mg.
5,8-dimethoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-amine (CAS 943119-42-4) is a chemical compound with the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. IUPAC name: 5,8-dimethoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-amine. InChIKey: FSNNMBVVDWKKCB-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 5,8-dimethoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-amine |
| InChIKey | FSNNMBVVDWKKCB-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)OC)SC3=NN=C(N23)N |
Computed by PubChem (NCBI)