cas: 189224-26-8 — see every product listed under this CAS number, including other names
Ozagrel Sodium, >98.0%(HPLC)(T) (CAS 189224-26-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | O0660-1G |
| cas | 189224-26-8 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 324.87 Pln | |
| TCI | 5g | 1229.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate (CAS 189224-26-8) is a chemical compound with the molecular formula C13H11N2NaO2 and a molecular weight of 250.23 g/mol. IUPAC name: sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate. InChIKey: NCNYJCOBUTXCBR-IPZCTEOASA-M.
| Molecular formula | C13H11N2NaO2 |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate |
| InChIKey | NCNYJCOBUTXCBR-IPZCTEOASA-M |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)/C=C/C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)