cas: 189224-26-8 — see every product listed under this CAS number, including other names
Ozagrel Sodium, 95%+, 95%+ (CAS 189224-26-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AOGO-1g |
| cas | 189224-26-8 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 270.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate (CAS 189224-26-8) is a chemical compound with the molecular formula C13H11N2NaO2 and a molecular weight of 250.23 g/mol. IUPAC name: sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate. InChIKey: NCNYJCOBUTXCBR-IPZCTEOASA-M.
| Molecular formula | C13H11N2NaO2 |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate |
| InChIKey | NCNYJCOBUTXCBR-IPZCTEOASA-M |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)/C=C/C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)