CAS 2225800-19-9 appears in our catalog under these names: PARP10-IN-3/ 99.54% (existing batch purity), PARP10–IN–3, 3-(4-carbamoylphenoxy)benzamide, 98%, 98%, PARP10-IN-3, 98.72%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg, 50 mg.
3-(4-carbamoylphenoxy)benzamide (CAS 2225800-19-9) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: 3-(4-carbamoylphenoxy)benzamide. InChIKey: PMOXYDXLQIUWHL-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 3-(4-carbamoylphenoxy)benzamide |
| InChIKey | PMOXYDXLQIUWHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)