Products 60044-24-8
CAS 60044-24-8 appears in our catalog under these names: PBB No. 49, PBB 49, PBB 49, Concentration: 100 µg/ml Solvent: Cyclohexane. Offered by: Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 5mg, 50mg, 25mg, 100mg, 1x1ml.
1,4-dibromo-2-(2,4-dibromophenyl)benzene (CAS 60044-24-8) is a chemical compound with the molecular formula C12H6Br4 and a molecular weight of 469.79 g/mol. IUPAC name: 1,4-dibromo-2-(2,4-dibromophenyl)benzene. InChIKey: LUASYBWZXWTYKK-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4 |
|---|---|
| Molecular weight | 469.79 g/mol |
| IUPAC name | 1,4-dibromo-2-(2,4-dibromophenyl)benzene |
| InChIKey | LUASYBWZXWTYKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)C2=C(C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
1,1'-Biphenyl, 2,2',4,5'-tetrabromo-, Biphenyl, 2,2',4',5-tetrabromo-, 2,2',4,5'-Tetrabromo-1,1'-biphenyl, 2,4-dibromo-1-(2,5-dibromophenyl)benzene, 2,2',4,5-Tetrabromobiphenyl, LUASYBWZXWTYKK-UHFFFAOYSA-N, 1,4-dibromo-2-(2,4-dibromophenyl)benzene, PBB No. 49, PBB-No. 49, 2,2',4,5'-Tetrabromo-1,1'-biphenyl #