PBRM1-BD2-IN-7
cas: 2819989-68-7 — see every product listed under this CAS number, including other names
PBRM1-BD2-IN-7 (CAS 2819989-68-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg. Offered by: TargetMol, Chemat, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T60155-1mg |
| cas | 2819989-68-7 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 937.32 Pln | |
| TargetMol | 5mg | 1893.21 Pln | |
| TargetMol | 10mg | 2690.35 Pln | |
| TargetMol | 25mg | 3932.44 Pln | |
| TargetMol | 50mg | 5459.63 Pln | |
| TargetMol | 100mg | 7265.76 Pln | |
| TargetMol | 500mg | 14457.85 Pln | |
| Chemat | 1mg | 371.60 Pln | |
| Chemat | 5mg | 789.20 Pln | |
| Chemat | 10mg | 1134.80 Pln | |
| Chemat | 25mg | 1763.60 Pln | |
| Chemat | 50mg | 2397.20 Pln | |
| Chemat | 100mg | 3222.80 Pln | |
| MedChemExpress | 1 mg | 1629.30 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
5-chloro-2-(2,6-dimethylphenyl)-2,3-dihydro-1H-quinazolin-4-one (CAS 2819989-68-7) is a chemical compound with the molecular formula C16H15ClN2O and a molecular weight of 286.75 g/mol. IUPAC name: 5-chloro-2-(2,6-dimethylphenyl)-2,3-dihydro-1H-quinazolin-4-one. InChIKey: OKLYBCNMVQMCRF-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | 5-chloro-2-(2,6-dimethylphenyl)-2,3-dihydro-1H-quinazolin-4-one |
| InChIKey | OKLYBCNMVQMCRF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2NC3=C(C(=CC=C3)Cl)C(=O)N2 |
Computed by PubChem (NCBI)