CAS 16758-87-5 appears in our catalog under these names: Etifoxine Impurity 5, Etifoxine Impurity 1, Etifoxine Desmethyl impurity. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
6-chloro-N-ethyl-4-phenyl-1,4-dihydro-3,1-benzoxazin-2-imine (CAS 16758-87-5) is a chemical compound with the molecular formula C16H15ClN2O and a molecular weight of 286.75 g/mol. IUPAC name: 6-chloro-N-ethyl-4-phenyl-1,4-dihydro-3,1-benzoxazin-2-imine. InChIKey: UBTQURXIKQMINI-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | 6-chloro-N-ethyl-4-phenyl-1,4-dihydro-3,1-benzoxazin-2-imine |
| InChIKey | UBTQURXIKQMINI-UHFFFAOYSA-N |
| SMILES | CCN=C1NC2=C(C=C(C=C2)Cl)C(O1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)