CAS 1354952-30-9 appears in our catalog under these names: 2-Chloro-N-(4-(2,3-dihydro-1H-indol-1-yl)phenyl)acetamide, 95%, 2-Chloro-N-(4-(2,3-dihydro-1H-indol-1-yl)phenyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-chloro-N-[4-(2,3-dihydroindol-1-yl)phenyl]acetamide (CAS 1354952-30-9) is a chemical compound with the molecular formula C16H15ClN2O and a molecular weight of 286.75 g/mol. IUPAC name: 2-chloro-N-[4-(2,3-dihydroindol-1-yl)phenyl]acetamide. InChIKey: DBCXVEIQFRNKSU-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | 2-chloro-N-[4-(2,3-dihydroindol-1-yl)phenyl]acetamide |
| InChIKey | DBCXVEIQFRNKSU-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C3=CC=C(C=C3)NC(=O)CCl |
Computed by PubChem (NCBI)