CAS 40678-73-7 is the registry number for Estazolam Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N'-(2-benzoyl-4-chlorophenyl)-N,N-dimethylmethanimidamide (CAS 40678-73-7) is a chemical compound with the molecular formula C16H15ClN2O and a molecular weight of 286.75 g/mol. IUPAC name: N'-(2-benzoyl-4-chlorophenyl)-N,N-dimethylmethanimidamide. InChIKey: IMDBCUZFBKBACV-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | N'-(2-benzoyl-4-chlorophenyl)-N,N-dimethylmethanimidamide |
| InChIKey | IMDBCUZFBKBACV-UHFFFAOYSA-N |
| SMILES | CN(C)C=NC1=C(C=C(C=C1)Cl)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)