Products 1153515-25-3
CAS 1153515-25-3 appears in our catalog under these names: 6-Amino-1-((4-chlorophenyl)methyl)-1,2,3,4-tetrahydroquinolin-2-one, 95%, 6-Amino-1-((4-chlorophenyl)methyl)-1,2,3,4-tetrahydroquinolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
6-amino-1-[(4-chlorophenyl)methyl]-3,4-dihydroquinolin-2-one (CAS 1153515-25-3) is a chemical compound with the molecular formula C16H15ClN2O and a molecular weight of 286.75 g/mol. IUPAC name: 6-amino-1-[(4-chlorophenyl)methyl]-3,4-dihydroquinolin-2-one. InChIKey: UMPKHDMMGVXPIP-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2O |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | 6-amino-1-[(4-chlorophenyl)methyl]-3,4-dihydroquinolin-2-one |
| InChIKey | UMPKHDMMGVXPIP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C2=C1C=C(C=C2)N)CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)