cas: 72596-74-8 — see every product listed under this CAS number, including other names
PD 404182, 98%, 98% (CAS 72596-74-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 25mg, 100mg, 5mg, 10mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FRPV-1mg |
| cas | 72596-74-8 |
| size | 1mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 525.20 Pln | |
| Chemat | 25mg | 3448.40 Pln | |
| Chemat | 100mg | 6678.80 Pln | |
| Chemat | 5mg | 1182.80 Pln | |
| Chemat | 10mg | 1864.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine (CAS 72596-74-8) is a chemical compound with the molecular formula C11H11N3S and a molecular weight of 217.29 g/mol. IUPAC name: 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine. InChIKey: JNENSSREQFBZGT-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine |
| InChIKey | JNENSSREQFBZGT-UHFFFAOYSA-N |
| SMILES | C1CN=C2C3=CC=CC=C3SC(=N)N2C1 |
Computed by PubChem (NCBI)