cas: 72596-74-8 — see every product listed under this CAS number, including other names
PD 404182, 98.26% (CAS 72596-74-8) is a chemical reagent available from Chemat. Available pack sizes: 5 mg, 10 mg, 10mM/1mL, 25 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-16958-5 mg |
| cas | 72596-74-8 |
| size | 5 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 mg | 551.89 Pln | |
| MedChemExpress | 10 mg | 793.38 Pln | |
| MedChemExpress | 10mM/1mL | 593.69 Pln | |
| MedChemExpress | 25 mg | 1462.12 Pln | |
| MedChemExpress | 50 mg | 2279.46 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.26% |
3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine (CAS 72596-74-8) is a chemical compound with the molecular formula C11H11N3S and a molecular weight of 217.29 g/mol. IUPAC name: 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine. InChIKey: JNENSSREQFBZGT-UHFFFAOYSA-N.
| Molecular formula | C11H11N3S |
|---|---|
| Molecular weight | 217.29 g/mol |
| IUPAC name | 3,4-dihydro-2H-pyrimido[1,2-c][1,3]benzothiazin-6-imine |
| InChIKey | JNENSSREQFBZGT-UHFFFAOYSA-N |
| SMILES | C1CN=C2C3=CC=CC=C3SC(=N)N2C1 |
Computed by PubChem (NCBI)