CAS 587852-28-6 appears in our catalog under these names: SMI-16a/ 99.78% (existing batch purity), 5-[(4-Propyloxyphenyl)methylene] 2,4-thiazolidinedione, PIM1/2 Kinase Inhibitor VI 1PC X 5MG, SMI-16a, 98%, 98%, SMI-16a, 98.0%. Offered by: TargetMol, Chemat, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg.
(5E)-5-[(4-propoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 587852-28-6) is a chemical compound with the molecular formula C13H13NO3S and a molecular weight of 263.31 g/mol. IUPAC name: (5E)-5-[(4-propoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: GBWOSXZUTXXXQF-DHZHZOJOSA-N.
| Molecular formula | C13H13NO3S |
|---|---|
| Molecular weight | 263.31 g/mol |
| IUPAC name | (5E)-5-[(4-propoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | GBWOSXZUTXXXQF-DHZHZOJOSA-N |
| SMILES | CCCOC1=CC=C(C=C1)/C=C/2\C(=O)NC(=O)S2 |
Computed by PubChem (NCBI)