CAS 2924858-25-1 appears in our catalog under these names: PT–179, PT-179/ 99.59% (existing batch purity), PT-179 95%, PT-179, 99.91%, 2-(2,6-dioxopiperidin-3-yl)-5-morpholinoisoindoline-1,3-dione, 95%, 95%. Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 500mg, 250mg.
2-(2,6-dioxopiperidin-3-yl)-5-morpholin-4-ylisoindole-1,3-dione (CAS 2924858-25-1) is a chemical compound with the molecular formula C17H17N3O5 and a molecular weight of 343.33 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-5-morpholin-4-ylisoindole-1,3-dione. InChIKey: CCCSRHUSXCBFJZ-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O5 |
|---|---|
| Molecular weight | 343.33 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-5-morpholin-4-ylisoindole-1,3-dione |
| InChIKey | CCCSRHUSXCBFJZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)N4CCOCC4 |
Computed by PubChem (NCBI)