CAS 2765218-56-0 appears in our catalog under these names: PY–60, PY-60/ 99.32% (existing batch purity), PY-60 98%, 5-Phenyl-N-(3-(thiazol-2-yl)propyl)isoxazole-3-carboxamide, 99.67% ,, 99.67% ,, PY-60, 99.42%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 500mg.
5-phenyl-N-[3-(1,3-thiazol-2-yl)propyl]-1,2-oxazole-3-carboxamide (CAS 2765218-56-0) is a chemical compound with the molecular formula C16H15N3O2S and a molecular weight of 313.4 g/mol. IUPAC name: 5-phenyl-N-[3-(1,3-thiazol-2-yl)propyl]-1,2-oxazole-3-carboxamide. InChIKey: UFASECSYKSMYET-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2S |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 5-phenyl-N-[3-(1,3-thiazol-2-yl)propyl]-1,2-oxazole-3-carboxamide |
| InChIKey | UFASECSYKSMYET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)C(=O)NCCCC3=NC=CS3 |
Computed by PubChem (NCBI)