cas: 3029-19-4 — see every product listed under this CAS number, including other names
PYRENE-1-CARBALDEHYDE, 98%, 98% (CAS 3029-19-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZHB-1g |
| cas | 3029-19-4 |
| size | 1g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 50g | 376.40 Pln | |
| Chemat | 100g | 678.80 Pln | |
| Chemat | 250g | 1576.40 Pln | |
| Chemat | 1kg | 3050.00 Pln | |
| Chemat | 5kg | 15417.60 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Pyrene-1-carbaldehyde (CAS 3029-19-4) is a chemical compound with the molecular formula C17H10O and a molecular weight of 230.26 g/mol. IUPAC name: pyrene-1-carbaldehyde. InChIKey: RCYFOPUXRMOLQM-UHFFFAOYSA-N.
| Molecular formula | C17H10O |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | pyrene-1-carbaldehyde |
| InChIKey | RCYFOPUXRMOLQM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)C=O |
Computed by PubChem (NCBI)